C10H17N3OS — CID 124508353
(2S)-1-(5-piperidin-1-yl-1,2,4-thiadiazol-3-yl)propan-2-ol (PubChem CID 124508353) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is (2S)-1-(5-piperidin-1-yl-1,2,4-thiadiazol-3-yl)propan-2-ol.
| Compound Name | (2S)-1-(5-piperidin-1-yl-1,2,4-thiadiazol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 124508353 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S)-1-(5-piperidin-1-yl-1,2,4-thiadiazol-3-yl)propan-2-ol |
| SMILES | C[C@H](O)Cc1nsc(N2CCCCC2)n1 |
| InChI | InChI=1S/C10H17N3OS/c1-8(14)7-9-11-10(15-12-9)13-5-3-2-4-6-13/h8,14H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | FQKYRUVPIKRWRO-QMMMGPOBSA-N |
| XLogP | 1.45 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |