C10H10N4OS — CID 9113696
4-thieno[2,3-d]pyrimidin-4-ylpiperazin-2-one (PubChem CID 9113696) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-thieno[2,3-d]pyrimidin-4-ylpiperazin-2-one.
| Compound Name | 4-thieno[2,3-d]pyrimidin-4-ylpiperazin-2-one |
|---|---|
| PubChem CID | 9113696 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-thieno[2,3-d]pyrimidin-4-ylpiperazin-2-one |
| SMILES | O=C1CN(c2ncnc3sccc23)CCN1 |
| InChI | InChI=1S/C10H10N4OS/c15-8-5-14(3-2-11-8)9-7-1-4-16-10(7)13-6-12-9/h1,4,6H,2-3,5H2,(H,11,15) |
| InChIKey | GDFAQKYHVHELEF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |