C12H14N4OS — CID 95617650
(7S)-7-methyl-1-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-5-one (PubChem CID 95617650) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is (7S)-7-methyl-1-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-5-one.
| Compound Name | (7S)-7-methyl-1-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95617650 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (7S)-7-methyl-1-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-5-one |
| SMILES | C[C@H]1CC(=O)NCCN1c1ncnc2sccc12 |
| InChI | InChI=1S/C12H14N4OS/c1-8-6-10(17)13-3-4-16(8)11-9-2-5-18-12(9)15-7-14-11/h2,5,7-8H,3-4,6H2,1H3,(H,13,17)/t8-/m0/s1 |
| InChIKey | ZPSNFNGKEVUOCR-QMMMGPOBSA-N |
| XLogP | 1.41 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |