C11H13N3OS — CID 103725139
3-methyl-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-ol (PubChem CID 103725139) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-methyl-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-ol.
| Compound Name | 3-methyl-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103725139 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-methyl-1-thieno[2,3-d]pyrimidin-4-ylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(c2ncnc3sccc23)C1 |
| InChI | InChI=1S/C11H13N3OS/c1-11(15)3-4-14(6-11)9-8-2-5-16-10(8)13-7-12-9/h2,5,7,15H,3-4,6H2,1H3 |
| InChIKey | HVWZFCZABSBQTB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |