C17H17N3O2S — CID 163307342
(3S,4S)-4-phenyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3,4-diol (PubChem CID 163307342) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is (3S,4S)-4-phenyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3,4-diol.
| Compound Name | (3S,4S)-4-phenyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 163307342 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (3S,4S)-4-phenyl-1-thieno[2,3-d]pyrimidin-4-ylpiperidine-3,4-diol |
| SMILES | O[C@H]1CN(c2ncnc3sccc23)CC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2S/c21-14-10-20(15-13-6-9-23-16(13)19-11-18-15)8-7-17(14,22)12-4-2-1-3-5-12/h1-6,9,11,14,21-22H,7-8,10H2/t14-,17-/m0/s1 |
| InChIKey | GZAANCNTWBMFPW-YOEHRIQHSA-N |
| XLogP | 2.15 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |