C9H9N5O — CID 62685201
3-(3-oxopiperazin-1-yl)pyrazine-2-carbonitrile (PubChem CID 62685201) has the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-(3-oxopiperazin-1-yl)pyrazine-2-carbonitrile.
| Compound Name | 3-(3-oxopiperazin-1-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 62685201 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3-(3-oxopiperazin-1-yl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCNC(=O)C1 |
| InChI | InChI=1S/C9H9N5O/c10-5-7-9(13-2-1-11-7)14-4-3-12-8(15)6-14/h1-2H,3-4,6H2,(H,12,15) |
| InChIKey | LTIVSLTVJJIUFY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |