C11H12ClN3O3 — CID 65363492
5-chloro-6-(3-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid (PubChem CID 65363492) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is 5-chloro-6-(3-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(3-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 65363492 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 5-chloro-6-(3-oxo-1,4-diazepan-1-yl)pyridine-3-carboxylic acid |
| SMILES | O=C1CN(c2ncc(C(=O)O)cc2Cl)CCCN1 |
| InChI | InChI=1S/C11H12ClN3O3/c12-8-4-7(11(17)18)5-14-10(8)15-3-1-2-13-9(16)6-15/h4-5H,1-3,6H2,(H,13,16)(H,17,18) |
| InChIKey | RCFSAFPIHHJYGU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |