C10H12ClN3O — CID 103756757
4-(2-chloro-4-pyridinyl)-1,4-diazepan-2-one (PubChem CID 103756757) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is 4-(2-chloro-4-pyridinyl)-1,4-diazepan-2-one.
| Compound Name | 4-(2-chloro-4-pyridinyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 103756757 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-(2-chloro-4-pyridinyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(c2ccnc(Cl)c2)CCCN1 |
| InChI | InChI=1S/C10H12ClN3O/c11-9-6-8(2-4-12-9)14-5-1-3-13-10(15)7-14/h2,4,6H,1,3,5,7H2,(H,13,15) |
| InChIKey | QJEFDOJTQFREAM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|