C14H20ClN3O — CID 65361647
4-[3-chloro-4-[1-(methylamino)ethyl]phenyl]-1,4-diazepan-2-one (PubChem CID 65361647) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 4-[3-chloro-4-[1-(methylamino)ethyl]phenyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-chloro-4-[1-(methylamino)ethyl]phenyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65361647 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[3-chloro-4-[1-(methylamino)ethyl]phenyl]-1,4-diazepan-2-one |
| SMILES | CNC(C)c1ccc(N2CCCNC(=O)C2)cc1Cl |
| InChI | InChI=1S/C14H20ClN3O/c1-10(16-2)12-5-4-11(8-13(12)15)18-7-3-6-17-14(19)9-18/h4-5,8,10,16H,3,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | HFDLLFDUIMWNLJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|