C11H13N3O3 — CID 65363741
4-(3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid (PubChem CID 65363741) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-(3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid.
| Compound Name | 4-(3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 65363741 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid |
| SMILES | O=C1CN(c2ccnc(C(=O)O)c2)CCCN1 |
| InChI | InChI=1S/C11H13N3O3/c15-10-7-14(5-1-3-13-10)8-2-4-12-9(6-8)11(16)17/h2,4,6H,1,3,5,7H2,(H,13,15)(H,16,17) |
| InChIKey | HAWBHJDLCKMJPT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |