2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid

C9H11N3O3S — CID 80568485

IUPAC2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid
SMILESO=C1CN(c2nc(C(=O)O)cs2)CCCN1
InChIInChI=1S/C9H11N3O3S/c13-7-4-12(3-1-2-10-7)9-11-6(5-16-9)8(14)15/h5H,1-4H2,(H,10,13)(H,14,15)
InChIKeyMIOVBUVXNUXPHQ-UHFFFAOYSA-N
MW241.27 g/mol
LogP0.17
Rot. Bonds2

About 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid

2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 80568485) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid
PubChem CID80568485
Molecular FormulaC9H11N3O3S
Molecular Weight241.27 g/mol
Exact Mass241.05
IUPAC Name2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid
SMILESO=C1CN(c2nc(C(=O)O)cs2)CCCN1
InChIInChI=1S/C9H11N3O3S/c13-7-4-12(3-1-2-10-7)9-11-6(5-16-9)8(14)15/h5H,1-4H2,(H,10,13)(H,14,15)
InChIKeyMIOVBUVXNUXPHQ-UHFFFAOYSA-N
XLogP0.17
TPSA82.53 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.27
LogP ≤ 50.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid (CID 80568485) is 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid is O=C1CN(c2nc(C(=O)O)cs2)CCCN1.
What is the InChIKey of 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is MIOVBUVXNUXPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3S/c13-7-4-12(3-1-2-10-7)9-11-6(5-16-9)8(14)15/h5H,1-4H2,(H,10,13)(H,14,15).
What are the key properties of 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid?
2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 241.27 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 80568485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).