C9H11N3O3S — CID 80568485
2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 80568485) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 80568485 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(3-oxo-1,4-diazepan-1-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C1CN(c2nc(C(=O)O)cs2)CCCN1 |
| InChI | InChI=1S/C9H11N3O3S/c13-7-4-12(3-1-2-10-7)9-11-6(5-16-9)8(14)15/h5H,1-4H2,(H,10,13)(H,14,15) |
| InChIKey | MIOVBUVXNUXPHQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |