C9H9N3O4S — CID 115424764
methyl 2-(3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylate (PubChem CID 115424764) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is methyl 2-(3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 115424764 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | methyl 2-(3,5-dioxopiperazin-1-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C9H9N3O4S/c1-16-8(15)5-4-17-9(10-5)12-2-6(13)11-7(14)3-12/h4H,2-3H2,1H3,(H,11,13,14) |
| InChIKey | KUFBKKQMRXOBEY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|