About methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate
methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate (PubChem CID 115423691) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 115423691 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(N2CCCC2C)n1 |
| InChI | InChI=1S/C10H14N2O2S/c1-7-4-3-5-12(7)10-11-8(6-15-10)9(13)14-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | BJNHYSQXLJDZIG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate (CID 115423691) is methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate is COC(=O)c1csc(N2CCCC2C)n1.
What is the InChIKey of methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is BJNHYSQXLJDZIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-7-4-3-5-12(7)10-11-8(6-15-10)9(13)14-2/h6-7H,3-5H2,1-2H3.
What are the key properties of methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate?
methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 226.30 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methylpyrrolidin-1-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 115423691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).