C12H18N2O2S — CID 80576345
2-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 80576345) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 80576345 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC1CCCCCN1c1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-5-3-2-4-6-14(9)12-13-10(8-17-12)7-11(15)16/h8-9H,2-7H2,1H3,(H,15,16) |
| InChIKey | WBGGRHQEDNFOOC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |