C12H18N2OS — CID 63844473
1-[1-(4-ethyl-1,3-thiazol-2-yl)piperidin-2-yl]ethanone (PubChem CID 63844473) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-[1-(4-ethyl-1,3-thiazol-2-yl)piperidin-2-yl]ethanone.
| Compound Name | 1-[1-(4-ethyl-1,3-thiazol-2-yl)piperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 63844473 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[1-(4-ethyl-1,3-thiazol-2-yl)piperidin-2-yl]ethanone |
| SMILES | CCc1csc(N2CCCCC2C(C)=O)n1 |
| InChI | InChI=1S/C12H18N2OS/c1-3-10-8-16-12(13-10)14-7-5-4-6-11(14)9(2)15/h8,11H,3-7H2,1-2H3 |
| InChIKey | VTAQMDHVGFSQKB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |