C15H24N2O2S — CID 103487795
ethyl 3-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]propanoate (PubChem CID 103487795) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is ethyl 3-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103487795 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethyl 3-[2-(2-methylazepan-1-yl)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(N2CCCCCC2C)n1 |
| InChI | InChI=1S/C15H24N2O2S/c1-3-19-14(18)9-8-13-11-20-15(16-13)17-10-6-4-5-7-12(17)2/h11-12H,3-10H2,1-2H3 |
| InChIKey | GUSHZTXCOKOZHD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |