C10H13BrN2OS — CID 79399962
1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-2-yl]ethanone (PubChem CID 79399962) has the molecular formula C10H13BrN2OS and a molecular weight of 289.20 g/mol. Its IUPAC name is 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-2-yl]ethanone.
| Compound Name | 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 79399962 |
| Molecular Formula | C10H13BrN2OS |
| Molecular Weight | 289.20 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 1-[1-(4-bromo-1,3-thiazol-2-yl)piperidin-2-yl]ethanone |
| SMILES | CC(=O)C1CCCCN1c1nc(Br)cs1 |
| InChI | InChI=1S/C10H13BrN2OS/c1-7(14)8-4-2-3-5-13(8)10-12-9(11)6-15-10/h6,8H,2-5H2,1H3 |
| InChIKey | CQRSJMYUEHGAGY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |