C13H18N2OS — CID 82751506
1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-4-yl]ethanone (PubChem CID 82751506) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 82751506 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C13H18N2OS/c1-9(16)11-8-17-13(14-11)15-7-6-10-4-2-3-5-12(10)15/h8,10,12H,2-7H2,1H3 |
| InChIKey | OAMPMIRQPBTETE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |