C11H15ClN2S — CID 130978354
2-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl)-4-(chloromethyl)-1,3-thiazole (PubChem CID 130978354) has the molecular formula C11H15ClN2S and a molecular weight of 242.77 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl)-4-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl)-4-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 130978354 |
| Molecular Formula | C11H15ClN2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl)-4-(chloromethyl)-1,3-thiazole |
| SMILES | ClCc1csc(N2CCC3CCCC32)n1 |
| InChI | InChI=1S/C11H15ClN2S/c12-6-9-7-15-11(13-9)14-5-4-8-2-1-3-10(8)14/h7-8,10H,1-6H2 |
| InChIKey | HBHFHNUHHUMTSH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|