C11H18ClN3S — CID 62890368
1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 62890368) has the molecular formula C11H18ClN3S and a molecular weight of 259.81 g/mol. Its IUPAC name is 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 62890368 |
| Molecular Formula | C11H18ClN3S |
| Molecular Weight | 259.81 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-[1-[4-(chloromethyl)-1,3-thiazol-2-yl]pyrrolidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCCN1c1nc(CCl)cs1 |
| InChI | InChI=1S/C11H18ClN3S/c1-14(2)7-10-4-3-5-15(10)11-13-9(6-12)8-16-11/h8,10H,3-7H2,1-2H3 |
| InChIKey | GDGGBJIHWUQNQG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|