C10H15ClN2S — CID 60974332
4-(chloromethyl)-2-(2-ethylpyrrolidin-1-yl)-1,3-thiazole (PubChem CID 60974332) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2-ethylpyrrolidin-1-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(2-ethylpyrrolidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 60974332 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-(chloromethyl)-2-(2-ethylpyrrolidin-1-yl)-1,3-thiazole |
| SMILES | CCC1CCCN1c1nc(CCl)cs1 |
| InChI | InChI=1S/C10H15ClN2S/c1-2-9-4-3-5-13(9)10-12-8(6-11)7-14-10/h7,9H,2-6H2,1H3 |
| InChIKey | WXXHNLPHOIYGIH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|