C9H12ClN3OS — CID 83155605
1-(4-chloro-1,3-thiazol-2-yl)piperidine-2-carboxamide (PubChem CID 83155605) has the molecular formula C9H12ClN3OS and a molecular weight of 245.73 g/mol. Its IUPAC name is 1-(4-chloro-1,3-thiazol-2-yl)piperidine-2-carboxamide.
| Compound Name | 1-(4-chloro-1,3-thiazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 83155605 |
| Molecular Formula | C9H12ClN3OS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-(4-chloro-1,3-thiazol-2-yl)piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1c1nc(Cl)cs1 |
| InChI | InChI=1S/C9H12ClN3OS/c10-7-5-15-9(12-7)13-4-2-1-3-6(13)8(11)14/h5-6H,1-4H2,(H2,11,14) |
| InChIKey | WNHJPSYKWIGSAV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |