methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate

C9H11ClN2O3S — CID 104775148

IUPACmethyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate
SMILESCOC(=O)C1COCCN1c1nc(Cl)cs1
InChIInChI=1S/C9H11ClN2O3S/c1-14-8(13)6-4-15-3-2-12(6)9-11-7(10)5-16-9/h5-6H,2-4H2,1H3
InChIKeyVYURIEIZQFJTEA-UHFFFAOYSA-N
MW262.72 g/mol
LogP1.17
Rot. Bonds2

About methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate

methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate (PubChem CID 104775148) has the molecular formula C9H11ClN2O3S and a molecular weight of 262.72 g/mol. Its IUPAC name is methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate
PubChem CID104775148
Molecular FormulaC9H11ClN2O3S
Molecular Weight262.72 g/mol
Exact Mass262.02
IUPAC Namemethyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate
SMILESCOC(=O)C1COCCN1c1nc(Cl)cs1
InChIInChI=1S/C9H11ClN2O3S/c1-14-8(13)6-4-15-3-2-12(6)9-11-7(10)5-16-9/h5-6H,2-4H2,1H3
InChIKeyVYURIEIZQFJTEA-UHFFFAOYSA-N
XLogP1.17
TPSA51.66 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.72
LogP ≤ 51.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate?
The IUPAC name of methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate (CID 104775148) is methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate.
What is the SMILES notation for methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate?
The canonical SMILES for methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate is COC(=O)C1COCCN1c1nc(Cl)cs1.
What is the InChIKey of methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate?
The InChIKey is VYURIEIZQFJTEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O3S/c1-14-8(13)6-4-15-3-2-12(6)9-11-7(10)5-16-9/h5-6H,2-4H2,1H3.
What are the key properties of methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate?
methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate has a molecular weight of 262.72 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-chloro-1,3-thiazol-2-yl)morpholine-3-carboxylate is sourced from PubChem (CID 104775148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).