C11H12ClNO4S — CID 104774896
methyl 4-(3-chlorothiophene-2-carbonyl)morpholine-3-carboxylate (PubChem CID 104774896) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is methyl 4-(3-chlorothiophene-2-carbonyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(3-chlorothiophene-2-carbonyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 104774896 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | methyl 4-(3-chlorothiophene-2-carbonyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)c1sccc1Cl |
| InChI | InChI=1S/C11H12ClNO4S/c1-16-11(15)8-6-17-4-3-13(8)10(14)9-7(12)2-5-18-9/h2,5,8H,3-4,6H2,1H3 |
| InChIKey | XHTCOPUTNBVAKQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |