C14H17NO5 — CID 124603692
methyl (3R)-4-(3-hydroxy-4-methylbenzoyl)morpholine-3-carboxylate (PubChem CID 124603692) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl (3R)-4-(3-hydroxy-4-methylbenzoyl)morpholine-3-carboxylate.
| Compound Name | methyl (3R)-4-(3-hydroxy-4-methylbenzoyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 124603692 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl (3R)-4-(3-hydroxy-4-methylbenzoyl)morpholine-3-carboxylate |
| SMILES | COC(=O)[C@H]1COCCN1C(=O)c1ccc(C)c(O)c1 |
| InChI | InChI=1S/C14H17NO5/c1-9-3-4-10(7-12(9)16)13(17)15-5-6-20-8-11(15)14(18)19-2/h3-4,7,11,16H,5-6,8H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZVOOEMUHMYUWGM-LLVKDONJSA-N |
| XLogP | 0.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |