C14H18N2O4 — CID 104774380
methyl 4-(4-amino-3-methylbenzoyl)morpholine-3-carboxylate (PubChem CID 104774380) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 4-(4-amino-3-methylbenzoyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(4-amino-3-methylbenzoyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 104774380 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 4-(4-amino-3-methylbenzoyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-9-7-10(3-4-11(9)15)13(17)16-5-6-20-8-12(16)14(18)19-2/h3-4,7,12H,5-6,8,15H2,1-2H3 |
| InChIKey | QDTOKVKZQWUAJC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|