C13H17N3O4 — CID 104774409
methyl 4-(2,4-diaminobenzoyl)morpholine-3-carboxylate (PubChem CID 104774409) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 4-(2,4-diaminobenzoyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(2,4-diaminobenzoyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 104774409 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | methyl 4-(2,4-diaminobenzoyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)c1ccc(N)cc1N |
| InChI | InChI=1S/C13H17N3O4/c1-19-13(18)11-7-20-5-4-16(11)12(17)9-3-2-8(14)6-10(9)15/h2-3,6,11H,4-5,7,14-15H2,1H3 |
| InChIKey | YSHNCBMMNCOFEO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|