C13H14FNO5 — CID 103889289
methyl 4-(4-fluoro-2-hydroxybenzoyl)morpholine-3-carboxylate (PubChem CID 103889289) has the molecular formula C13H14FNO5 and a molecular weight of 283.25 g/mol. Its IUPAC name is methyl 4-(4-fluoro-2-hydroxybenzoyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(4-fluoro-2-hydroxybenzoyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 103889289 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | methyl 4-(4-fluoro-2-hydroxybenzoyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C13H14FNO5/c1-19-13(18)10-7-20-5-4-15(10)12(17)9-3-2-8(14)6-11(9)16/h2-3,6,10,16H,4-5,7H2,1H3 |
| InChIKey | NAAQAPIXYZHBFX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |