C13H12ClF2NO4 — CID 115868973
methyl 4-(4-chloro-2,5-difluorobenzoyl)morpholine-3-carboxylate (PubChem CID 115868973) has the molecular formula C13H12ClF2NO4 and a molecular weight of 319.69 g/mol. Its IUPAC name is methyl 4-(4-chloro-2,5-difluorobenzoyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(4-chloro-2,5-difluorobenzoyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115868973 |
| Molecular Formula | C13H12ClF2NO4 |
| Molecular Weight | 319.69 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | methyl 4-(4-chloro-2,5-difluorobenzoyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H12ClF2NO4/c1-20-13(19)11-6-21-3-2-17(11)12(18)7-4-10(16)8(14)5-9(7)15/h4-5,11H,2-3,6H2,1H3 |
| InChIKey | ZGPISTRMRLFYKP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.69 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|