C12H13ClN2O4 — CID 115670216
methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate (PubChem CID 115670216) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate.
| Compound Name | methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670216 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C12H13ClN2O4/c1-18-12(17)10-7-19-5-4-15(10)11(16)9-6-8(13)2-3-14-9/h2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | SXMMUGLYQYNEEN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |