methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate

C12H13ClN2O4 — CID 115670216

IUPACmethyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate
SMILESCOC(=O)C1COCCN1C(=O)c1cc(Cl)ccn1
InChIInChI=1S/C12H13ClN2O4/c1-18-12(17)10-7-19-5-4-15(10)11(16)9-6-8(13)2-3-14-9/h2-3,6,10H,4-5,7H2,1H3
InChIKeySXMMUGLYQYNEEN-UHFFFAOYSA-N
MW284.70 g/mol
LogP0.75
Rot. Bonds2

About methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate

methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate (PubChem CID 115670216) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate
PubChem CID115670216
Molecular FormulaC12H13ClN2O4
Molecular Weight284.70 g/mol
Exact Mass284.06
IUPAC Namemethyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate
SMILESCOC(=O)C1COCCN1C(=O)c1cc(Cl)ccn1
InChIInChI=1S/C12H13ClN2O4/c1-18-12(17)10-7-19-5-4-15(10)11(16)9-6-8(13)2-3-14-9/h2-3,6,10H,4-5,7H2,1H3
InChIKeySXMMUGLYQYNEEN-UHFFFAOYSA-N
XLogP0.75
TPSA68.73 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.70
LogP ≤ 50.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate?
The IUPAC name of methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate (CID 115670216) is methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate.
What is the SMILES notation for methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate?
The canonical SMILES for methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate is COC(=O)C1COCCN1C(=O)c1cc(Cl)ccn1.
What is the InChIKey of methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate?
The InChIKey is SXMMUGLYQYNEEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O4/c1-18-12(17)10-7-19-5-4-15(10)11(16)9-6-8(13)2-3-14-9/h2-3,6,10H,4-5,7H2,1H3.
What are the key properties of methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate?
methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate has a molecular weight of 284.70 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-chloropyridine-2-carbonyl)morpholine-3-carboxylate is sourced from PubChem (CID 115670216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).