methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate

C11H13ClN2O3 — CID 104775121

IUPACmethyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate
SMILESCOC(=O)C1COCCN1c1ncccc1Cl
InChIInChI=1S/C11H13ClN2O3/c1-16-11(15)9-7-17-6-5-14(9)10-8(12)3-2-4-13-10/h2-4,9H,5-7H2,1H3
InChIKeyQXPGMCKMOGDUAG-UHFFFAOYSA-N
MW256.69 g/mol
LogP1.11
Rot. Bonds2

About methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate

methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate (PubChem CID 104775121) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate
PubChem CID104775121
Molecular FormulaC11H13ClN2O3
Molecular Weight256.69 g/mol
Exact Mass256.06
IUPAC Namemethyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate
SMILESCOC(=O)C1COCCN1c1ncccc1Cl
InChIInChI=1S/C11H13ClN2O3/c1-16-11(15)9-7-17-6-5-14(9)10-8(12)3-2-4-13-10/h2-4,9H,5-7H2,1H3
InChIKeyQXPGMCKMOGDUAG-UHFFFAOYSA-N
XLogP1.11
TPSA51.66 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.69
LogP ≤ 51.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate?
The IUPAC name of methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate (CID 104775121) is methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate.
What is the SMILES notation for methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate?
The canonical SMILES for methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate is COC(=O)C1COCCN1c1ncccc1Cl.
What is the InChIKey of methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate?
The InChIKey is QXPGMCKMOGDUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O3/c1-16-11(15)9-7-17-6-5-14(9)10-8(12)3-2-4-13-10/h2-4,9H,5-7H2,1H3.
What are the key properties of methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate?
methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate has a molecular weight of 256.69 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-chloro-2-pyridinyl)morpholine-3-carboxylate is sourced from PubChem (CID 104775121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).