C12H15ClN2O2 — CID 115538344
methyl 1-(3-chloro-2-pyridinyl)piperidine-2-carboxylate (PubChem CID 115538344) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is methyl 1-(3-chloro-2-pyridinyl)piperidine-2-carboxylate.
| Compound Name | methyl 1-(3-chloro-2-pyridinyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 115538344 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | methyl 1-(3-chloro-2-pyridinyl)piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1c1ncccc1Cl |
| InChI | InChI=1S/C12H15ClN2O2/c1-17-12(16)10-6-2-3-8-15(10)11-9(13)5-4-7-14-11/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | YRULLYIFAOHRBJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |