C11H12Cl2N2O2 — CID 146387890
methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate (PubChem CID 146387890) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 146387890 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1c1ccc(Cl)c(Cl)n1 |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-17-11(16)8-3-2-6-15(8)9-5-4-7(12)10(13)14-9/h4-5,8H,2-3,6H2,1H3 |
| InChIKey | HEFGKPJPPCJPLM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|