methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate

C11H12Cl2N2O2 — CID 146387890

IUPACmethyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate
SMILESCOC(=O)C1CCCN1c1ccc(Cl)c(Cl)n1
InChIInChI=1S/C11H12Cl2N2O2/c1-17-11(16)8-3-2-6-15(8)9-5-4-7(12)10(13)14-9/h4-5,8H,2-3,6H2,1H3
InChIKeyHEFGKPJPPCJPLM-UHFFFAOYSA-N
MW275.13 g/mol
LogP2.53
Rot. Bonds2

About methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate

methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate (PubChem CID 146387890) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namemethyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate
PubChem CID146387890
Molecular FormulaC11H12Cl2N2O2
Molecular Weight275.13 g/mol
Exact Mass274.03
IUPAC Namemethyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate
SMILESCOC(=O)C1CCCN1c1ccc(Cl)c(Cl)n1
InChIInChI=1S/C11H12Cl2N2O2/c1-17-11(16)8-3-2-6-15(8)9-5-4-7(12)10(13)14-9/h4-5,8H,2-3,6H2,1H3
InChIKeyHEFGKPJPPCJPLM-UHFFFAOYSA-N
XLogP2.53
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.13
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate (CID 146387890) is methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate is COC(=O)C1CCCN1c1ccc(Cl)c(Cl)n1.
What is the InChIKey of methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate?
The InChIKey is HEFGKPJPPCJPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O2/c1-17-11(16)8-3-2-6-15(8)9-5-4-7(12)10(13)14-9/h4-5,8H,2-3,6H2,1H3.
What are the key properties of methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate?
methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate has a molecular weight of 275.13 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(5,6-dichloro-2-pyridinyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 146387890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).