C12H15N3O2S — CID 43473976
methyl 1-(5-carbamothioyl-2-pyridinyl)pyrrolidine-2-carboxylate (PubChem CID 43473976) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is methyl 1-(5-carbamothioyl-2-pyridinyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(5-carbamothioyl-2-pyridinyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43473976 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl 1-(5-carbamothioyl-2-pyridinyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1c1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C12H15N3O2S/c1-17-12(16)9-3-2-6-15(9)10-5-4-8(7-14-10)11(13)18/h4-5,7,9H,2-3,6H2,1H3,(H2,13,18) |
| InChIKey | LOIBIGDQFYDVCM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|