C13H17N3O3 — CID 115538439
methyl 1-(5-carbamoyl-2-pyridinyl)piperidine-3-carboxylate (PubChem CID 115538439) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is methyl 1-(5-carbamoyl-2-pyridinyl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(5-carbamoyl-2-pyridinyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 115538439 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | methyl 1-(5-carbamoyl-2-pyridinyl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(c2ccc(C(N)=O)cn2)C1 |
| InChI | InChI=1S/C13H17N3O3/c1-19-13(18)10-3-2-6-16(8-10)11-5-4-9(7-15-11)12(14)17/h4-5,7,10H,2-3,6,8H2,1H3,(H2,14,17) |
| InChIKey | UMYLTEPDXHPWLD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |