C9H12N4O — CID 65250216
6-(3-aminoazetidin-1-yl)pyridine-3-carboxamide (PubChem CID 65250216) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-(3-aminoazetidin-1-yl)pyridine-3-carboxamide.
| Compound Name | 6-(3-aminoazetidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 65250216 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 6-(3-aminoazetidin-1-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CC(N)C2)nc1 |
| InChI | InChI=1S/C9H12N4O/c10-7-4-13(5-7)8-2-1-6(3-12-8)9(11)14/h1-3,7H,4-5,10H2,(H2,11,14) |
| InChIKey | KFADUQUKJOUYMO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |