C13H18N4O — CID 162767740
6-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-3-carboxamide (PubChem CID 162767740) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-3-carboxamide.
| Compound Name | 6-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162767740 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 6-(2,7-diazaspiro[3.5]nonan-7-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCC3(CC2)CNC3)nc1 |
| InChI | InChI=1S/C13H18N4O/c14-12(18)10-1-2-11(16-7-10)17-5-3-13(4-6-17)8-15-9-13/h1-2,7,15H,3-6,8-9H2,(H2,14,18) |
| InChIKey | REGMPJJEJRSSDK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |