6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid

C15H22N2O2 — CID 63161227

IUPAC6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid
SMILESCCC1(CC)CCN(c2ccc(C(=O)O)cn2)CC1
InChIInChI=1S/C15H22N2O2/c1-3-15(4-2)7-9-17(10-8-15)13-6-5-12(11-16-13)14(18)19/h5-6,11H,3-4,7-10H2,1-2H3,(H,18,19)
InChIKeyKTXLMPWBXOUUQI-UHFFFAOYSA-N
MW262.35 g/mol
LogP3.19
Rot. Bonds4

About 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid

6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid (PubChem CID 63161227) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid
PubChem CID63161227
Molecular FormulaC15H22N2O2
Molecular Weight262.35 g/mol
Exact Mass262.17
IUPAC Name6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid
SMILESCCC1(CC)CCN(c2ccc(C(=O)O)cn2)CC1
InChIInChI=1S/C15H22N2O2/c1-3-15(4-2)7-9-17(10-8-15)13-6-5-12(11-16-13)14(18)19/h5-6,11H,3-4,7-10H2,1-2H3,(H,18,19)
InChIKeyKTXLMPWBXOUUQI-UHFFFAOYSA-N
XLogP3.19
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 53.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid?
The IUPAC name of 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid (CID 63161227) is 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid is CCC1(CC)CCN(c2ccc(C(=O)O)cn2)CC1.
What is the InChIKey of 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid?
The InChIKey is KTXLMPWBXOUUQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-3-15(4-2)7-9-17(10-8-15)13-6-5-12(11-16-13)14(18)19/h5-6,11H,3-4,7-10H2,1-2H3,(H,18,19).
What are the key properties of 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid?
6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid has a molecular weight of 262.35 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,4-diethylpiperidin-1-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 63161227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).