C19H25N3O3 — CID 72928045
6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylic acid (PubChem CID 72928045) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 72928045 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 6-[2-(3-methylbut-2-enyl)-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylic acid |
| SMILES | CC(C)=CCN1CC2(CCN(c3ccc(C(=O)O)cn3)CC2)CC1=O |
| InChI | InChI=1S/C19H25N3O3/c1-14(2)5-8-22-13-19(11-17(22)23)6-9-21(10-7-19)16-4-3-15(12-20-16)18(24)25/h3-5,12H,6-11,13H2,1-2H3,(H,24,25) |
| InChIKey | HBGQQTUEDVJYLI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|