C18H21N3O — CID 166186710
6-(4-phenylazepan-1-yl)pyridine-3-carboxamide (PubChem CID 166186710) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 6-(4-phenylazepan-1-yl)pyridine-3-carboxamide.
| Compound Name | 6-(4-phenylazepan-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166186710 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 6-(4-phenylazepan-1-yl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCCC(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C18H21N3O/c19-18(22)16-8-9-17(20-13-16)21-11-4-7-15(10-12-21)14-5-2-1-3-6-14/h1-3,5-6,8-9,13,15H,4,7,10-12H2,(H2,19,22) |
| InChIKey | NZKGURKVFZYSCM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |