About 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide
4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 167811448) has the molecular formula C16H21N5O
and a molecular weight of 299.38 g/mol. Its IUPAC name is 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 167811448 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1c(C(N)=O)nnc1N1CCCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N5O/c1-20-15(14(17)22)18-19-16(20)21-10-5-8-13(9-11-21)12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3,(H2,17,22) |
| InChIKey | CNRVUNIFLUTICZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide (CID 167811448) is 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide is Cn1c(C(N)=O)nnc1N1CCCC(c2ccccc2)CC1.
What is the InChIKey of 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide?
The InChIKey is CNRVUNIFLUTICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5O/c1-20-15(14(17)22)18-19-16(20)21-10-5-8-13(9-11-21)12-6-3-2-4-7-12/h2-4,6-7,13H,5,8-11H2,1H3,(H2,17,22).
What are the key properties of 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide?
4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide has a molecular weight of 299.38 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(4-phenylazepan-1-yl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 167811448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).