C17H20ClN3 — CID 133286642
1-(6-chloro-2-methylpyrimidin-4-yl)-4-phenylazepane (PubChem CID 133286642) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 1-(6-chloro-2-methylpyrimidin-4-yl)-4-phenylazepane.
| Compound Name | 1-(6-chloro-2-methylpyrimidin-4-yl)-4-phenylazepane |
|---|---|
| PubChem CID | 133286642 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(6-chloro-2-methylpyrimidin-4-yl)-4-phenylazepane |
| SMILES | Cc1nc(Cl)cc(N2CCCC(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H20ClN3/c1-13-19-16(18)12-17(20-13)21-10-5-8-15(9-11-21)14-6-3-2-4-7-14/h2-4,6-7,12,15H,5,8-11H2,1H3 |
| InChIKey | YUFZYNYGBNQORQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |