C18H22ClN3 — CID 95789765
4-chloro-2-methyl-6-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]pyrimidine (PubChem CID 95789765) has the molecular formula C18H22ClN3 and a molecular weight of 315.85 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]pyrimidine.
| Compound Name | 4-chloro-2-methyl-6-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 95789765 |
| Molecular Formula | C18H22ClN3 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-chloro-2-methyl-6-[(2S)-2-[(1S)-1-phenylpropyl]pyrrolidin-1-yl]pyrimidine |
| SMILES | CC[C@@H](c1ccccc1)[C@@H]1CCCN1c1cc(Cl)nc(C)n1 |
| InChI | InChI=1S/C18H22ClN3/c1-3-15(14-8-5-4-6-9-14)16-10-7-11-22(16)18-12-17(19)20-13(2)21-18/h4-6,8-9,12,15-16H,3,7,10-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | JMCCOLNASMVXQJ-HOTGVXAUSA-N |
| XLogP | 4.60 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |