C17H21ClN4O — CID 95314204
(1R)-2-[4-(6-chloro-2-methylpyrimidin-4-yl)piperazin-1-yl]-1-phenylethanol (PubChem CID 95314204) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is (1R)-2-[4-(6-chloro-2-methylpyrimidin-4-yl)piperazin-1-yl]-1-phenylethanol.
| Compound Name | (1R)-2-[4-(6-chloro-2-methylpyrimidin-4-yl)piperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 95314204 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (1R)-2-[4-(6-chloro-2-methylpyrimidin-4-yl)piperazin-1-yl]-1-phenylethanol |
| SMILES | Cc1nc(Cl)cc(N2CCN(C[C@H](O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H21ClN4O/c1-13-19-16(18)11-17(20-13)22-9-7-21(8-10-22)12-15(23)14-5-3-2-4-6-14/h2-6,11,15,23H,7-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | RNMRIEKBBJQDIN-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |