C18H23N3O — CID 111462476
1-phenyl-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethanol (PubChem CID 111462476) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-phenyl-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethanol.
| Compound Name | 1-phenyl-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 111462476 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-phenyl-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethanol |
| SMILES | OC(CN1CCN(Cc2ccncc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O/c22-18(17-4-2-1-3-5-17)15-21-12-10-20(11-13-21)14-16-6-8-19-9-7-16/h1-9,18,22H,10-15H2 |
| InChIKey | VEBIIJIJDJWHHF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |