C17H24N4O — CID 56778681
2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-1-phenylethanol (PubChem CID 56778681) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-1-phenylethanol.
| Compound Name | 2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 56778681 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-1-phenylethanol |
| SMILES | Cn1ccnc1CN1CCN(CC(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-19-8-7-18-17(19)14-21-11-9-20(10-12-21)13-16(22)15-5-3-2-4-6-15/h2-8,16,22H,9-14H2,1H3 |
| InChIKey | VJWSECBXMVXGOS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |