C16H29N5O2 — CID 154737586
1-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-3-morpholin-4-ylpropan-2-ol (PubChem CID 154737586) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 154737586 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 1-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]-3-morpholin-4-ylpropan-2-ol |
| SMILES | Cn1ccnc1CN1CCN(CC(O)CN2CCOCC2)CC1 |
| InChI | InChI=1S/C16H29N5O2/c1-18-3-2-17-16(18)14-20-6-4-19(5-7-20)12-15(22)13-21-8-10-23-11-9-21/h2-3,15,22H,4-14H2,1H3 |
| InChIKey | ULLKZDJOPGWMPY-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 57.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |