C19H25N5O3 — CID 3737847
N-[1-hydroxy-2-[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]benzamide (PubChem CID 3737847) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[1-hydroxy-2-[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[1-hydroxy-2-[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 3737847 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[1-hydroxy-2-[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
| SMILES | Cn1ccnc1CN1CCCN(C(=O)C(O)NC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N5O3/c1-22-11-8-20-16(22)14-23-9-5-10-24(13-12-23)19(27)18(26)21-17(25)15-6-3-2-4-7-15/h2-4,6-8,11,18,26H,5,9-10,12-14H2,1H3,(H,21,25) |
| InChIKey | KEKWFLHYAMIPCY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|