C20H27N5O2S — CID 3854553
ethyl 2-[[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]benzoate (PubChem CID 3854553) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is ethyl 2-[[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]benzoate.
| Compound Name | ethyl 2-[[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3854553 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | ethyl 2-[[4-[(1-methylimidazol-2-yl)methyl]-1,4-diazepane-1-carbothioyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=S)N1CCCN(Cc2nccn2C)CC1 |
| InChI | InChI=1S/C20H27N5O2S/c1-3-27-19(26)16-7-4-5-8-17(16)22-20(28)25-11-6-10-24(13-14-25)15-18-21-9-12-23(18)2/h4-5,7-9,12H,3,6,10-11,13-15H2,1-2H3,(H,22,28) |
| InChIKey | ZMNNEZTYPSVRMB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|