C22H27N3O4 — CID 113108045
ethyl 2-[[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 113108045) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl 2-[[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113108045 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl 2-[[4-[(2-methoxyphenyl)methyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1CCN(Cc2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H27N3O4/c1-3-29-21(26)18-9-5-6-10-19(18)23-22(27)25-14-12-24(13-15-25)16-17-8-4-7-11-20(17)28-2/h4-11H,3,12-16H2,1-2H3,(H,23,27) |
| InChIKey | JPDTXIDMGGIRGI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |